C27H33N5O4S — CID 3628381
2-[[4-cyclohexyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(2,3,4-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 3628381) has the molecular formula C27H33N5O4S and a molecular weight of 523.66 g/mol. Its IUPAC name is 2-[[4-cyclohexyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(2,3,4-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[4-cyclohexyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(2,3,4-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3628381 |
| Molecular Formula | C27H33N5O4S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 2-[[4-cyclohexyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(2,3,4-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(C=NNC(=O)CSc2nnc(-c3ccc(C)cc3)n2C2CCCCC2)c(OC)c1OC |
| InChI | InChI=1S/C27H33N5O4S/c1-18-10-12-19(13-11-18)26-30-31-27(32(26)21-8-6-5-7-9-21)37-17-23(33)29-28-16-20-14-15-22(34-2)25(36-4)24(20)35-3/h10-16,21H,5-9,17H2,1-4H3,(H,29,33) |
| InChIKey | MVLUVOQMUYDMBW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|