About ethyl 1-[3-[(3,4-difluorophenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate
ethyl 1-[3-[(3,4-difluorophenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate (PubChem CID 3629245) has the molecular formula C27H22F2N2O3
and a molecular weight of 460.48 g/mol. Its IUPAC name is ethyl 1-[3-[(3,4-difluorophenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[3-[(3,4-difluorophenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate |
| PubChem CID | 3629245 |
| Molecular Formula | C27H22F2N2O3 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | ethyl 1-[3-[(3,4-difluorophenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)n(-c2cccc(C(=O)Nc3ccc(F)c(F)c3)c2)c1C |
| InChI | InChI=1S/C27H22F2N2O3/c1-3-34-27(33)22-16-25(18-8-5-4-6-9-18)31(17(22)2)21-11-7-10-19(14-21)26(32)30-20-12-13-23(28)24(29)15-20/h4-16H,3H2,1-2H3,(H,30,32) |
| InChIKey | XEZBHAUPHQLCNB-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-[3-[(3,4-difluorophenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[3-[(3,4-difluorophenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate?
The IUPAC name of ethyl 1-[3-[(3,4-difluorophenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate (CID 3629245) is ethyl 1-[3-[(3,4-difluorophenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate.
What is the SMILES notation for ethyl 1-[3-[(3,4-difluorophenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate?
The canonical SMILES for ethyl 1-[3-[(3,4-difluorophenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate is CCOC(=O)c1cc(-c2ccccc2)n(-c2cccc(C(=O)Nc3ccc(F)c(F)c3)c2)c1C.
What is the InChIKey of ethyl 1-[3-[(3,4-difluorophenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate?
The InChIKey is XEZBHAUPHQLCNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22F2N2O3/c1-3-34-27(33)22-16-25(18-8-5-4-6-9-18)31(17(22)2)21-11-7-10-19(14-21)26(32)30-20-12-13-23(28)24(29)15-20/h4-16H,3H2,1-2H3,(H,30,32).
What are the key properties of ethyl 1-[3-[(3,4-difluorophenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate?
ethyl 1-[3-[(3,4-difluorophenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate has a molecular weight of 460.48 g/mol, XLogP of 6.16, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[3-[(3,4-difluorophenyl)carbamoyl]phenyl]-2-methyl-5-phenylpyrrole-3-carboxylate is sourced from PubChem (CID 3629245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).