C17H20N2O4 — CID 3631012
ethyl 3-(2,5-dimethylpyrrol-1-yl)-3-(4-nitrophenyl)propanoate (PubChem CID 3631012) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is ethyl 3-(2,5-dimethylpyrrol-1-yl)-3-(4-nitrophenyl)propanoate.
| Compound Name | ethyl 3-(2,5-dimethylpyrrol-1-yl)-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 3631012 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | ethyl 3-(2,5-dimethylpyrrol-1-yl)-3-(4-nitrophenyl)propanoate |
| SMILES | CCOC(=O)CC(c1ccc([N+](=O)[O-])cc1)n1c(C)ccc1C |
| InChI | InChI=1S/C17H20N2O4/c1-4-23-17(20)11-16(18-12(2)5-6-13(18)3)14-7-9-15(10-8-14)19(21)22/h5-10,16H,4,11H2,1-3H3 |
| InChIKey | MXMHMHHOPWTZIG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 74.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_N(1)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|