C19H20ClN3S — CID 3631316
N-butyl-2-[(3-chlorophenyl)methylsulfanyl]quinazolin-4-amine (PubChem CID 3631316) has the molecular formula C19H20ClN3S and a molecular weight of 357.91 g/mol. Its IUPAC name is N-butyl-2-[(3-chlorophenyl)methylsulfanyl]quinazolin-4-amine.
| Compound Name | N-butyl-2-[(3-chlorophenyl)methylsulfanyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 3631316 |
| Molecular Formula | C19H20ClN3S |
| Molecular Weight | 357.91 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-butyl-2-[(3-chlorophenyl)methylsulfanyl]quinazolin-4-amine |
| SMILES | CCCCNc1nc(SCc2cccc(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C19H20ClN3S/c1-2-3-11-21-18-16-9-4-5-10-17(16)22-19(23-18)24-13-14-7-6-8-15(20)12-14/h4-10,12H,2-3,11,13H2,1H3,(H,21,22,23) |
| InChIKey | NKCIWWRMXHZRPJ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.91 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|