C12H12F3N3S — CID 154837193
N-ethyl-2-(2,2,2-trifluoroethylsulfanyl)quinazolin-4-amine (PubChem CID 154837193) has the molecular formula C12H12F3N3S and a molecular weight of 287.31 g/mol. Its IUPAC name is N-ethyl-2-(2,2,2-trifluoroethylsulfanyl)quinazolin-4-amine.
| Compound Name | N-ethyl-2-(2,2,2-trifluoroethylsulfanyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 154837193 |
| Molecular Formula | C12H12F3N3S |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | N-ethyl-2-(2,2,2-trifluoroethylsulfanyl)quinazolin-4-amine |
| SMILES | CCNc1nc(SCC(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C12H12F3N3S/c1-2-16-10-8-5-3-4-6-9(8)17-11(18-10)19-7-12(13,14)15/h3-6H,2,7H2,1H3,(H,16,17,18) |
| InChIKey | VYSBKDIWQCMTRW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |