C20H21FN4OS — CID 40766769
2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-N-[(3-fluorophenyl)methyl]-N-methylacetamide (PubChem CID 40766769) has the molecular formula C20H21FN4OS and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-N-[(3-fluorophenyl)methyl]-N-methylacetamide.
| Compound Name | 2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-N-[(3-fluorophenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 40766769 |
| Molecular Formula | C20H21FN4OS |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-N-[(3-fluorophenyl)methyl]-N-methylacetamide |
| SMILES | CCNc1nc(SCC(=O)N(C)Cc2cccc(F)c2)nc2ccccc12 |
| InChI | InChI=1S/C20H21FN4OS/c1-3-22-19-16-9-4-5-10-17(16)23-20(24-19)27-13-18(26)25(2)12-14-7-6-8-15(21)11-14/h4-11H,3,12-13H2,1-2H3,(H,22,23,24) |
| InChIKey | NCTLOPPELWHOKH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |