C14H17N3O2S — CID 51237217
methyl 2-[4-(ethylamino)quinazolin-2-yl]sulfanylpropanoate (PubChem CID 51237217) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is methyl 2-[4-(ethylamino)quinazolin-2-yl]sulfanylpropanoate.
| Compound Name | methyl 2-[4-(ethylamino)quinazolin-2-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 51237217 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | methyl 2-[4-(ethylamino)quinazolin-2-yl]sulfanylpropanoate |
| SMILES | CCNc1nc(SC(C)C(=O)OC)nc2ccccc12 |
| InChI | InChI=1S/C14H17N3O2S/c1-4-15-12-10-7-5-6-8-11(10)16-14(17-12)20-9(2)13(18)19-3/h5-9H,4H2,1-3H3,(H,15,16,17) |
| InChIKey | LDKUTEBBJBZKAS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |