C15H17N3O2S — CID 154752589
methyl 2-[4-(cyclopropylamino)quinazolin-2-yl]sulfanylpropanoate (PubChem CID 154752589) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is methyl 2-[4-(cyclopropylamino)quinazolin-2-yl]sulfanylpropanoate.
| Compound Name | methyl 2-[4-(cyclopropylamino)quinazolin-2-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 154752589 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | methyl 2-[4-(cyclopropylamino)quinazolin-2-yl]sulfanylpropanoate |
| SMILES | COC(=O)C(C)Sc1nc(NC2CC2)c2ccccc2n1 |
| InChI | InChI=1S/C15H17N3O2S/c1-9(14(19)20-2)21-15-17-12-6-4-3-5-11(12)13(18-15)16-10-7-8-10/h3-6,9-10H,7-8H2,1-2H3,(H,16,17,18) |
| InChIKey | FJIDIQSJCFYYJV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |