C12H10F5N3 — CID 62173751
N-ethyl-2-(1,1,2,2,2-pentafluoroethyl)quinazolin-4-amine (PubChem CID 62173751) has the molecular formula C12H10F5N3 and a molecular weight of 291.22 g/mol. Its IUPAC name is N-ethyl-2-(1,1,2,2,2-pentafluoroethyl)quinazolin-4-amine.
| Compound Name | N-ethyl-2-(1,1,2,2,2-pentafluoroethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 62173751 |
| Molecular Formula | C12H10F5N3 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-ethyl-2-(1,1,2,2,2-pentafluoroethyl)quinazolin-4-amine |
| SMILES | CCNc1nc(C(F)(F)C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C12H10F5N3/c1-2-18-9-7-5-3-4-6-8(7)19-10(20-9)11(13,14)12(15,16)17/h3-6H,2H2,1H3,(H,18,19,20) |
| InChIKey | NJSCRCJRJILQCL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|