C21H20N2O2S — CID 3633056
5-[[4-(dimethylamino)phenyl]methylidene]-2-[2-(4-methylphenyl)-2-oxoethylidene]-1,3-thiazolidin-4-one (PubChem CID 3633056) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is 5-[[4-(dimethylamino)phenyl]methylidene]-2-[2-(4-methylphenyl)-2-oxoethylidene]-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-(dimethylamino)phenyl]methylidene]-2-[2-(4-methylphenyl)-2-oxoethylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3633056 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 5-[[4-(dimethylamino)phenyl]methylidene]-2-[2-(4-methylphenyl)-2-oxoethylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(C(=O)C=c2[nH]c(=O)c(=Cc3ccc(N(C)C)cc3)s2)cc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-14-4-8-16(9-5-14)18(24)13-20-22-21(25)19(26-20)12-15-6-10-17(11-7-15)23(2)3/h4-13H,1-3H3,(H,22,25) |
| InChIKey | PTPIDVRZVKAMBU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|