C20H16ClN3O4S — CID 4793376
2-[2-(4-chlorophenyl)-2-oxoethylidene]-5-[[4-(dimethylamino)-3-nitrophenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 4793376) has the molecular formula C20H16ClN3O4S and a molecular weight of 429.89 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-oxoethylidene]-5-[[4-(dimethylamino)-3-nitrophenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[2-(4-chlorophenyl)-2-oxoethylidene]-5-[[4-(dimethylamino)-3-nitrophenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4793376 |
| Molecular Formula | C20H16ClN3O4S |
| Molecular Weight | 429.89 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-oxoethylidene]-5-[[4-(dimethylamino)-3-nitrophenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CN(C)c1ccc(C=c2sc(=CC(=O)c3ccc(Cl)cc3)[nH]c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16ClN3O4S/c1-23(2)15-8-3-12(9-16(15)24(27)28)10-18-20(26)22-19(29-18)11-17(25)13-4-6-14(21)7-5-13/h3-11H,1-2H3,(H,22,26) |
| InChIKey | GCXHDJHKRZIBDF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 96.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.89 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|