C30H37BrN2O6 — CID 3633123
3-bromo-N-[[3,5,14-trihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methylideneamino]benzamide (PubChem CID 3633123) has the molecular formula C30H37BrN2O6 and a molecular weight of 601.54 g/mol. Its IUPAC name is 3-bromo-N-[[3,5,14-trihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methylideneamino]benzamide.
| Compound Name | 3-bromo-N-[[3,5,14-trihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 3633123 |
| Molecular Formula | C30H37BrN2O6 |
| Molecular Weight | 601.54 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | 3-bromo-N-[[3,5,14-trihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methylideneamino]benzamide |
| SMILES | CC12CCC3C(CCC4(O)CC(O)CCC34C=NNC(=O)c3cccc(Br)c3)C1(O)CCC2C1=CC(=O)OC1 |
| InChI | InChI=1S/C30H37BrN2O6/c1-27-9-6-23-24(30(27,38)12-8-22(27)19-14-25(35)39-16-19)7-11-29(37)15-21(34)5-10-28(23,29)17-32-33-26(36)18-3-2-4-20(31)13-18/h2-4,13-14,17,21-24,34,37-38H,5-12,15-16H2,1H3,(H,33,36) |
| InChIKey | GDAPGKILSITURB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|