C12H26N3O3S+ — CID 3636219
2-[(1-ethylsulfonylpiperidine-4-carbonyl)amino]ethyl-dimethylazanium (PubChem CID 3636219) has the molecular formula C12H26N3O3S+ and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-[(1-ethylsulfonylpiperidine-4-carbonyl)amino]ethyl-dimethylazanium.
| Compound Name | 2-[(1-ethylsulfonylpiperidine-4-carbonyl)amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 3636219 |
| Molecular Formula | C12H26N3O3S+ |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2-[(1-ethylsulfonylpiperidine-4-carbonyl)amino]ethyl-dimethylazanium |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)NCC[NH+](C)C)CC1 |
| InChI | InChI=1S/C12H25N3O3S/c1-4-19(17,18)15-8-5-11(6-9-15)12(16)13-7-10-14(2)3/h11H,4-10H2,1-3H3,(H,13,16)/p+1 |
| InChIKey | CAPCSHDFAQHSGJ-UHFFFAOYSA-O |
| XLogP | -1.69 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |