C12H22N2O6S — CID 103879591
methyl 3-[(1-ethylsulfonylpiperidine-4-carbonyl)amino]-2-hydroxypropanoate (PubChem CID 103879591) has the molecular formula C12H22N2O6S and a molecular weight of 322.38 g/mol. Its IUPAC name is methyl 3-[(1-ethylsulfonylpiperidine-4-carbonyl)amino]-2-hydroxypropanoate.
| Compound Name | methyl 3-[(1-ethylsulfonylpiperidine-4-carbonyl)amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 103879591 |
| Molecular Formula | C12H22N2O6S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | methyl 3-[(1-ethylsulfonylpiperidine-4-carbonyl)amino]-2-hydroxypropanoate |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)NCC(O)C(=O)OC)CC1 |
| InChI | InChI=1S/C12H22N2O6S/c1-3-21(18,19)14-6-4-9(5-7-14)11(16)13-8-10(15)12(17)20-2/h9-10,15H,3-8H2,1-2H3,(H,13,16) |
| InChIKey | ULOJQOAUXFREGP-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |