C16H14NO8S2- — CID 3638106
2-[[3,5-bis(methoxycarbonyl)-4-methylthiophen-2-yl]sulfonylamino]benzoate (PubChem CID 3638106) has the molecular formula C16H14NO8S2- and a molecular weight of 412.42 g/mol. Its IUPAC name is 2-[[3,5-bis(methoxycarbonyl)-4-methylthiophen-2-yl]sulfonylamino]benzoate.
| Compound Name | 2-[[3,5-bis(methoxycarbonyl)-4-methylthiophen-2-yl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 3638106 |
| Molecular Formula | C16H14NO8S2- |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 2-[[3,5-bis(methoxycarbonyl)-4-methylthiophen-2-yl]sulfonylamino]benzoate |
| SMILES | COC(=O)c1sc(S(=O)(=O)Nc2ccccc2C(=O)[O-])c(C(=O)OC)c1C |
| InChI | InChI=1S/C16H15NO8S2/c1-8-11(14(20)24-2)16(26-12(8)15(21)25-3)27(22,23)17-10-7-5-4-6-9(10)13(18)19/h4-7,17H,1-3H3,(H,18,19)/p-1 |
| InChIKey | PNVQLOACFHRKCN-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 138.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |