C21H32N4OS — CID 3639636
3-[butan-2-yl-[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]amino]-N-butylpropanamide (PubChem CID 3639636) has the molecular formula C21H32N4OS and a molecular weight of 388.58 g/mol. Its IUPAC name is 3-[butan-2-yl-[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]amino]-N-butylpropanamide.
| Compound Name | 3-[butan-2-yl-[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 3639636 |
| Molecular Formula | C21H32N4OS |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 3-[butan-2-yl-[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)CCN(c1nc(Cc2ccc(C)cc2)ns1)C(C)CC |
| InChI | InChI=1S/C21H32N4OS/c1-5-7-13-22-20(26)12-14-25(17(4)6-2)21-23-19(24-27-21)15-18-10-8-16(3)9-11-18/h8-11,17H,5-7,12-15H2,1-4H3,(H,22,26) |
| InChIKey | ZKRINMKXPBNQGF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|