C20H29ClN4OS — CID 3910416
3-[[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]-N-pentylpropanamide (PubChem CID 3910416) has the molecular formula C20H29ClN4OS and a molecular weight of 409.00 g/mol. Its IUPAC name is 3-[[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]-N-pentylpropanamide.
| Compound Name | 3-[[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]-N-pentylpropanamide |
|---|---|
| PubChem CID | 3910416 |
| Molecular Formula | C20H29ClN4OS |
| Molecular Weight | 409.00 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-[[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]-N-pentylpropanamide |
| SMILES | CCCCCNC(=O)CCN(c1nc(Cc2ccc(Cl)cc2)ns1)C(C)C |
| InChI | InChI=1S/C20H29ClN4OS/c1-4-5-6-12-22-19(26)11-13-25(15(2)3)20-23-18(24-27-20)14-16-7-9-17(21)10-8-16/h7-10,15H,4-6,11-14H2,1-3H3,(H,22,26) |
| InChIKey | HZSCSPNWGQURCE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.00 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|