C20H23N3O — CID 3641131
N-(benzhydrylideneamino)-2-pyrrolidin-1-ylpropanamide (PubChem CID 3641131) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is N-(benzhydrylideneamino)-2-pyrrolidin-1-ylpropanamide.
| Compound Name | N-(benzhydrylideneamino)-2-pyrrolidin-1-ylpropanamide |
|---|---|
| PubChem CID | 3641131 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | N-(benzhydrylideneamino)-2-pyrrolidin-1-ylpropanamide |
| SMILES | CC(C(=O)NN=C(c1ccccc1)c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C20H23N3O/c1-16(23-14-8-9-15-23)20(24)22-21-19(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-7,10-13,16H,8-9,14-15H2,1H3,(H,22,24) |
| InChIKey | WCYCWOUIYVIIQW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|