C28H22N4OS — CID 3641138
4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-phenylbenzamide (PubChem CID 3641138) has the molecular formula C28H22N4OS and a molecular weight of 462.58 g/mol. Its IUPAC name is 4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-phenylbenzamide.
| Compound Name | 4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 3641138 |
| Molecular Formula | C28H22N4OS |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 4-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(CSc2nnc(-c3ccccc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H22N4OS/c33-27(29-24-12-6-2-7-13-24)23-18-16-21(17-19-23)20-34-28-31-30-26(22-10-4-1-5-11-22)32(28)25-14-8-3-9-15-25/h1-19H,20H2,(H,29,33) |
| InChIKey | HPAUFRFSOLEZJF-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |