C23H19ClN4O2S — CID 42881928
4-[[4-(3-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-hydroxybenzamide (PubChem CID 42881928) has the molecular formula C23H19ClN4O2S and a molecular weight of 450.95 g/mol. Its IUPAC name is 4-[[4-(3-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-hydroxybenzamide.
| Compound Name | 4-[[4-(3-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 42881928 |
| Molecular Formula | C23H19ClN4O2S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 4-[[4-(3-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-hydroxybenzamide |
| SMILES | Cc1ccc(-c2nnc(SCc3ccc(C(=O)NO)cc3)n2-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C23H19ClN4O2S/c1-15-5-9-17(10-6-15)21-25-26-23(28(21)20-4-2-3-19(24)13-20)31-14-16-7-11-18(12-8-16)22(29)27-30/h2-13,30H,14H2,1H3,(H,27,29) |
| InChIKey | GHRHPHGVHHBTFE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|