C24H18ClFN2O2 — CID 3642555
1-[(4-chlorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-2-oxoquinoline-4-carboxamide (PubChem CID 3642555) has the molecular formula C24H18ClFN2O2 and a molecular weight of 420.87 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-2-oxoquinoline-4-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-2-oxoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3642555 |
| Molecular Formula | C24H18ClFN2O2 |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-[(4-fluorophenyl)methyl]-2-oxoquinoline-4-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cc(=O)n(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C24H18ClFN2O2/c25-18-9-5-17(6-10-18)15-28-22-4-2-1-3-20(22)21(13-23(28)29)24(30)27-14-16-7-11-19(26)12-8-16/h1-13H,14-15H2,(H,27,30) |
| InChIKey | UUELLGXFWFSGDU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |