C19H26ClN3O4 — CID 3643779
3-[1-(2-chloro-6-methoxypyridine-4-carbonyl)piperidin-4-yl]-4-(2-methylpropyl)-1,3-oxazolidin-2-one (PubChem CID 3643779) has the molecular formula C19H26ClN3O4 and a molecular weight of 395.89 g/mol. Its IUPAC name is 3-[1-(2-chloro-6-methoxypyridine-4-carbonyl)piperidin-4-yl]-4-(2-methylpropyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-[1-(2-chloro-6-methoxypyridine-4-carbonyl)piperidin-4-yl]-4-(2-methylpropyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 3643779 |
| Molecular Formula | C19H26ClN3O4 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3-[1-(2-chloro-6-methoxypyridine-4-carbonyl)piperidin-4-yl]-4-(2-methylpropyl)-1,3-oxazolidin-2-one |
| SMILES | COc1cc(C(=O)N2CCC(N3C(=O)OCC3CC(C)C)CC2)cc(Cl)n1 |
| InChI | InChI=1S/C19H26ClN3O4/c1-12(2)8-15-11-27-19(25)23(15)14-4-6-22(7-5-14)18(24)13-9-16(20)21-17(10-13)26-3/h9-10,12,14-15H,4-8,11H2,1-3H3 |
| InChIKey | DEMGUHHAOXLOJU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|