C16H20ClN3O4 — CID 3874973
3-[1-(2-chloro-6-methoxypyridine-4-carbonyl)piperidin-4-yl]-5-methyl-1,3-oxazolidin-2-one (PubChem CID 3874973) has the molecular formula C16H20ClN3O4 and a molecular weight of 353.81 g/mol. Its IUPAC name is 3-[1-(2-chloro-6-methoxypyridine-4-carbonyl)piperidin-4-yl]-5-methyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[1-(2-chloro-6-methoxypyridine-4-carbonyl)piperidin-4-yl]-5-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 3874973 |
| Molecular Formula | C16H20ClN3O4 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 3-[1-(2-chloro-6-methoxypyridine-4-carbonyl)piperidin-4-yl]-5-methyl-1,3-oxazolidin-2-one |
| SMILES | COc1cc(C(=O)N2CCC(N3CC(C)OC3=O)CC2)cc(Cl)n1 |
| InChI | InChI=1S/C16H20ClN3O4/c1-10-9-20(16(22)24-10)12-3-5-19(6-4-12)15(21)11-7-13(17)18-14(8-11)23-2/h7-8,10,12H,3-6,9H2,1-2H3 |
| InChIKey | BBMYOFDJDGILMN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|