C16H21Cl2N3O2 — CID 86846041
(2,6-dichloro-4-pyridinyl)-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]methanone (PubChem CID 86846041) has the molecular formula C16H21Cl2N3O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is (2,6-dichloro-4-pyridinyl)-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]methanone.
| Compound Name | (2,6-dichloro-4-pyridinyl)-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 86846041 |
| Molecular Formula | C16H21Cl2N3O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (2,6-dichloro-4-pyridinyl)-[4-(2-methylmorpholin-4-yl)piperidin-1-yl]methanone |
| SMILES | CC1CN(C2CCN(C(=O)c3cc(Cl)nc(Cl)c3)CC2)CCO1 |
| InChI | InChI=1S/C16H21Cl2N3O2/c1-11-10-21(6-7-23-11)13-2-4-20(5-3-13)16(22)12-8-14(17)19-15(18)9-12/h8-9,11,13H,2-7,10H2,1H3 |
| InChIKey | RWCONWZKHWSSMX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|