C15H24ClNO2S — CID 3647642
1-(2-chlorophenyl)-N-(6-methylheptan-2-yl)methanesulfonamide (PubChem CID 3647642) has the molecular formula C15H24ClNO2S and a molecular weight of 317.88 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(6-methylheptan-2-yl)methanesulfonamide.
| Compound Name | 1-(2-chlorophenyl)-N-(6-methylheptan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 3647642 |
| Molecular Formula | C15H24ClNO2S |
| Molecular Weight | 317.88 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(6-methylheptan-2-yl)methanesulfonamide |
| SMILES | CC(C)CCCC(C)NS(=O)(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C15H24ClNO2S/c1-12(2)7-6-8-13(3)17-20(18,19)11-14-9-4-5-10-15(14)16/h4-5,9-10,12-13,17H,6-8,11H2,1-3H3 |
| InChIKey | GECDEOHNYRVFCI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.88 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |