C16H18ClNO2S — CID 92673614
1-(2-chlorophenyl)-N-[(1R)-1-(4-methylphenyl)ethyl]methanesulfonamide (PubChem CID 92673614) has the molecular formula C16H18ClNO2S and a molecular weight of 323.85 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[(1R)-1-(4-methylphenyl)ethyl]methanesulfonamide.
| Compound Name | 1-(2-chlorophenyl)-N-[(1R)-1-(4-methylphenyl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 92673614 |
| Molecular Formula | C16H18ClNO2S |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[(1R)-1-(4-methylphenyl)ethyl]methanesulfonamide |
| SMILES | Cc1ccc([C@@H](C)NS(=O)(=O)Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C16H18ClNO2S/c1-12-7-9-14(10-8-12)13(2)18-21(19,20)11-15-5-3-4-6-16(15)17/h3-10,13,18H,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | DOASFLVLWVOQGK-CYBMUJFWSA-N |
| XLogP | 3.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |