C15H15F2NO2S — CID 93487236
1-(2-fluorophenyl)-N-[(1R)-1-(4-fluorophenyl)ethyl]methanesulfonamide (PubChem CID 93487236) has the molecular formula C15H15F2NO2S and a molecular weight of 311.35 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[(1R)-1-(4-fluorophenyl)ethyl]methanesulfonamide.
| Compound Name | 1-(2-fluorophenyl)-N-[(1R)-1-(4-fluorophenyl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 93487236 |
| Molecular Formula | C15H15F2NO2S |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[(1R)-1-(4-fluorophenyl)ethyl]methanesulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)Cc1ccccc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H15F2NO2S/c1-11(12-6-8-14(16)9-7-12)18-21(19,20)10-13-4-2-3-5-15(13)17/h2-9,11,18H,10H2,1H3/t11-/m1/s1 |
| InChIKey | FSWANMTUNAFEKN-LLVKDONJSA-N |
| XLogP | 3.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |