C16H11Br2N3O2 — CID 3648461
3-[(2,4-dibromo-6-hydroxyphenyl)methylideneamino]-2-methylquinazolin-4-one (PubChem CID 3648461) has the molecular formula C16H11Br2N3O2 and a molecular weight of 437.09 g/mol. Its IUPAC name is 3-[(2,4-dibromo-6-hydroxyphenyl)methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 3-[(2,4-dibromo-6-hydroxyphenyl)methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 3648461 |
| Molecular Formula | C16H11Br2N3O2 |
| Molecular Weight | 437.09 g/mol |
| Exact Mass | 434.92 |
| IUPAC Name | 3-[(2,4-dibromo-6-hydroxyphenyl)methylideneamino]-2-methylquinazolin-4-one |
| SMILES | Cc1nc2ccccc2c(=O)n1N=Cc1c(O)cc(Br)cc1Br |
| InChI | InChI=1S/C16H11Br2N3O2/c1-9-20-14-5-3-2-4-11(14)16(23)21(9)19-8-12-13(18)6-10(17)7-15(12)22/h2-8,22H,1H3 |
| InChIKey | ZWFDBYUENRTHNH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.09 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|