C22H19NO8 — CID 3648863
methyl 1-(4-ethoxycarbonylphenyl)-2-hydroxy-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidine-2-carboxylate (PubChem CID 3648863) has the molecular formula C22H19NO8 and a molecular weight of 425.39 g/mol. Its IUPAC name is methyl 1-(4-ethoxycarbonylphenyl)-2-hydroxy-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(4-ethoxycarbonylphenyl)-2-hydroxy-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 3648863 |
| Molecular Formula | C22H19NO8 |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | methyl 1-(4-ethoxycarbonylphenyl)-2-hydroxy-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C(=O)C(=C(O)c3ccccc3)C2(O)C(=O)OC)cc1 |
| InChI | InChI=1S/C22H19NO8/c1-3-31-20(27)14-9-11-15(12-10-14)23-19(26)18(25)16(22(23,29)21(28)30-2)17(24)13-7-5-4-6-8-13/h4-12,24,29H,3H2,1-2H3 |
| InChIKey | IIOMFZNIEGZOJE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|