C24H24N2O5 — CID 1492643
methyl (2R)-3-[hydroxy(phenyl)methylidene]-4,5-dioxo-1-phenyl-2-piperidin-1-ylpyrrolidine-2-carboxylate (PubChem CID 1492643) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is methyl (2R)-3-[hydroxy(phenyl)methylidene]-4,5-dioxo-1-phenyl-2-piperidin-1-ylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2R)-3-[hydroxy(phenyl)methylidene]-4,5-dioxo-1-phenyl-2-piperidin-1-ylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 1492643 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | methyl (2R)-3-[hydroxy(phenyl)methylidene]-4,5-dioxo-1-phenyl-2-piperidin-1-ylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@]1(N2CCCCC2)C(=C(O)c2ccccc2)C(=O)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C24H24N2O5/c1-31-23(30)24(25-15-9-4-10-16-25)19(20(27)17-11-5-2-6-12-17)21(28)22(29)26(24)18-13-7-3-8-14-18/h2-3,5-8,11-14,27H,4,9-10,15-16H2,1H3/t24-/m1/s1 |
| InChIKey | IRBSGOHSCPGQBZ-XMMPIXPASA-N |
| XLogP | 2.93 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|