C20H17NO7 — CID 5289960
methyl (3E)-2-hydroxy-3-[hydroxy-(4-methoxyphenyl)methylidene]-4,5-dioxo-1-phenylpyrrolidine-2-carboxylate (PubChem CID 5289960) has the molecular formula C20H17NO7 and a molecular weight of 383.36 g/mol. Its IUPAC name is methyl (3E)-2-hydroxy-3-[hydroxy-(4-methoxyphenyl)methylidene]-4,5-dioxo-1-phenylpyrrolidine-2-carboxylate.
| Compound Name | methyl (3E)-2-hydroxy-3-[hydroxy-(4-methoxyphenyl)methylidene]-4,5-dioxo-1-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 5289960 |
| Molecular Formula | C20H17NO7 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | methyl (3E)-2-hydroxy-3-[hydroxy-(4-methoxyphenyl)methylidene]-4,5-dioxo-1-phenylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1(O)/C(=C(\O)c2ccc(OC)cc2)C(=O)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C20H17NO7/c1-27-14-10-8-12(9-11-14)16(22)15-17(23)18(24)21(13-6-4-3-5-7-13)20(15,26)19(25)28-2/h3-11,22,26H,1-2H3/b16-15- |
| InChIKey | JOMGZAXCCAEWRM-NXVVXOECSA-N |
| XLogP | 1.44 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|