C11H9ClN2OS2 — CID 3650227
5-[(4-chlorophenyl)methyliminomethyl]-4-hydroxy-3H-1,3-thiazole-2-thione (PubChem CID 3650227) has the molecular formula C11H9ClN2OS2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methyliminomethyl]-4-hydroxy-3H-1,3-thiazole-2-thione.
| Compound Name | 5-[(4-chlorophenyl)methyliminomethyl]-4-hydroxy-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 3650227 |
| Molecular Formula | C11H9ClN2OS2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 5-[(4-chlorophenyl)methyliminomethyl]-4-hydroxy-3H-1,3-thiazole-2-thione |
| SMILES | Oc1[nH]c(=S)sc1/C=N/Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H9ClN2OS2/c12-8-3-1-7(2-4-8)5-13-6-9-10(15)14-11(16)17-9/h1-4,6,15H,5H2,(H,14,16)/b13-6+ |
| InChIKey | CXHZDSOQKBUXSG-AWNIVKPZSA-N |
| XLogP | 3.78 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|