C24H24N4O4S — CID 36518051
N-(1H-benzimidazol-2-ylmethyl)-4-methoxy-N-methyl-3-[(4-methylphenyl)sulfamoyl]benzamide (PubChem CID 36518051) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-4-methoxy-N-methyl-3-[(4-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-4-methoxy-N-methyl-3-[(4-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 36518051 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-4-methoxy-N-methyl-3-[(4-methylphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc(C(=O)N(C)Cc2nc3ccccc3[nH]2)cc1S(=O)(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C24H24N4O4S/c1-16-8-11-18(12-9-16)27-33(30,31)22-14-17(10-13-21(22)32-3)24(29)28(2)15-23-25-19-6-4-5-7-20(19)26-23/h4-14,27H,15H2,1-3H3,(H,25,26) |
| InChIKey | LKTWIEMLYAINJI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |