C23H24N2O3S — CID 4042579
N-benzyl-N,4-dimethyl-3-[(4-methylphenyl)sulfamoyl]benzamide (PubChem CID 4042579) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is N-benzyl-N,4-dimethyl-3-[(4-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-benzyl-N,4-dimethyl-3-[(4-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 4042579 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-benzyl-N,4-dimethyl-3-[(4-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc(C(=O)N(C)Cc3ccccc3)ccc2C)cc1 |
| InChI | InChI=1S/C23H24N2O3S/c1-17-9-13-21(14-10-17)24-29(27,28)22-15-20(12-11-18(22)2)23(26)25(3)16-19-7-5-4-6-8-19/h4-15,24H,16H2,1-3H3 |
| InChIKey | GSFZUKXVVZOXKG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |