C35H33FN2O6S — CID 3652136
methyl 6-tert-butyl-2-[3-[5-(4-fluorophenyl)furan-2-yl]-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3652136) has the molecular formula C35H33FN2O6S and a molecular weight of 628.72 g/mol. Its IUPAC name is methyl 6-tert-butyl-2-[3-[5-(4-fluorophenyl)furan-2-yl]-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 6-tert-butyl-2-[3-[5-(4-fluorophenyl)furan-2-yl]-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3652136 |
| Molecular Formula | C35H33FN2O6S |
| Molecular Weight | 628.72 g/mol |
| Exact Mass | 628.20 |
| IUPAC Name | methyl 6-tert-butyl-2-[3-[5-(4-fluorophenyl)furan-2-yl]-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N2C(=O)C3ON(c4ccccc4)C(c4ccc(-c5ccc(F)cc5)o4)C3C2=O)sc2c1CCC(C(C)(C)C)C2 |
| InChI | InChI=1S/C35H33FN2O6S/c1-35(2,3)20-12-15-23-26(18-20)45-33(27(23)34(41)42-4)37-31(39)28-29(25-17-16-24(43-25)19-10-13-21(36)14-11-19)38(44-30(28)32(37)40)22-8-6-5-7-9-22/h5-11,13-14,16-17,20,28-30H,12,15,18H2,1-4H3 |
| InChIKey | XADVKYJPWGMYDS-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.72 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|