C23H31FN2O2 — CID 3652203
N-butan-2-yl-5-[[cyclohexyl-[(3-fluorophenyl)methyl]amino]methyl]furan-2-carboxamide (PubChem CID 3652203) has the molecular formula C23H31FN2O2 and a molecular weight of 386.51 g/mol. Its IUPAC name is N-butan-2-yl-5-[[cyclohexyl-[(3-fluorophenyl)methyl]amino]methyl]furan-2-carboxamide.
| Compound Name | N-butan-2-yl-5-[[cyclohexyl-[(3-fluorophenyl)methyl]amino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3652203 |
| Molecular Formula | C23H31FN2O2 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | N-butan-2-yl-5-[[cyclohexyl-[(3-fluorophenyl)methyl]amino]methyl]furan-2-carboxamide |
| SMILES | CCC(C)NC(=O)c1ccc(CN(Cc2cccc(F)c2)C2CCCCC2)o1 |
| InChI | InChI=1S/C23H31FN2O2/c1-3-17(2)25-23(27)22-13-12-21(28-22)16-26(20-10-5-4-6-11-20)15-18-8-7-9-19(24)14-18/h7-9,12-14,17,20H,3-6,10-11,15-16H2,1-2H3,(H,25,27) |
| InChIKey | BXDQKKURZAKYLG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |