C18H25N2O2+ — CID 6945953
benzyl-[[5-[[(2S)-butan-2-yl]carbamoyl]furan-2-yl]methyl]-methylazanium (PubChem CID 6945953) has the molecular formula C18H25N2O2+ and a molecular weight of 301.41 g/mol. Its IUPAC name is benzyl-[[5-[[(2S)-butan-2-yl]carbamoyl]furan-2-yl]methyl]-methylazanium.
| Compound Name | benzyl-[[5-[[(2S)-butan-2-yl]carbamoyl]furan-2-yl]methyl]-methylazanium |
|---|---|
| PubChem CID | 6945953 |
| Molecular Formula | C18H25N2O2+ |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | benzyl-[[5-[[(2S)-butan-2-yl]carbamoyl]furan-2-yl]methyl]-methylazanium |
| SMILES | CC[C@H](C)NC(=O)c1ccc(C[NH+](C)Cc2ccccc2)o1 |
| InChI | InChI=1S/C18H24N2O2/c1-4-14(2)19-18(21)17-11-10-16(22-17)13-20(3)12-15-8-6-5-7-9-15/h5-11,14H,4,12-13H2,1-3H3,(H,19,21)/p+1/t14-/m0/s1 |
| InChIKey | ODLJTSQURWLQGO-AWEZNQCLSA-O |
| XLogP | 2.02 |
| TPSA | 46.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |