C18H16N4O2S — CID 36537470
3-(2-oxopyrrolidin-1-yl)-N-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]benzamide (PubChem CID 36537470) has the molecular formula C18H16N4O2S and a molecular weight of 352.42 g/mol. Its IUPAC name is 3-(2-oxopyrrolidin-1-yl)-N-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 3-(2-oxopyrrolidin-1-yl)-N-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 36537470 |
| Molecular Formula | C18H16N4O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 3-(2-oxopyrrolidin-1-yl)-N-[4-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(-c2ccc[nH]2)cs1)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C18H16N4O2S/c23-16-7-3-9-22(16)13-5-1-4-12(10-13)17(24)21-18-20-15(11-25-18)14-6-2-8-19-14/h1-2,4-6,8,10-11,19H,3,7,9H2,(H,20,21,24) |
| InChIKey | ZLXKVYRIGIPDLL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |