C23H22N2O5 — CID 36543552
2-(2-oxobenzo[cd]indol-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide (PubChem CID 36543552) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-(2-oxobenzo[cd]indol-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(2-oxobenzo[cd]indol-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 36543552 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-(2-oxobenzo[cd]indol-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
| SMILES | COc1cc(CNC(=O)CN2C(=O)c3cccc4cccc2c34)cc(OC)c1OC |
| InChI | InChI=1S/C23H22N2O5/c1-28-18-10-14(11-19(29-2)22(18)30-3)12-24-20(26)13-25-17-9-5-7-15-6-4-8-16(21(15)17)23(25)27/h4-11H,12-13H2,1-3H3,(H,24,26) |
| InChIKey | JYUHWNLEPWHSKU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |