C22H21F3N4O2 — CID 3654911
1-[2-methyl-6-[5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]pyrimidin-4-yl]piperidin-4-ol (PubChem CID 3654911) has the molecular formula C22H21F3N4O2 and a molecular weight of 430.43 g/mol. Its IUPAC name is 1-[2-methyl-6-[5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]pyrimidin-4-yl]piperidin-4-ol.
| Compound Name | 1-[2-methyl-6-[5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]pyrimidin-4-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 3654911 |
| Molecular Formula | C22H21F3N4O2 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 1-[2-methyl-6-[5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]pyrimidin-4-yl]piperidin-4-ol |
| SMILES | Cc1nc(-c2cncc(-c3ccc(OC(F)(F)F)cc3)c2)cc(N2CCC(O)CC2)n1 |
| InChI | InChI=1S/C22H21F3N4O2/c1-14-27-20(11-21(28-14)29-8-6-18(30)7-9-29)17-10-16(12-26-13-17)15-2-4-19(5-3-15)31-22(23,24)25/h2-5,10-13,18,30H,6-9H2,1H3 |
| InChIKey | ALNQGEZLPOSZFA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |