C20H23N3O2 — CID 3655252
N-(2-methylphenyl)-N'-[(4-propan-2-ylphenyl)methylideneamino]propanediamide (PubChem CID 3655252) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-(2-methylphenyl)-N'-[(4-propan-2-ylphenyl)methylideneamino]propanediamide.
| Compound Name | N-(2-methylphenyl)-N'-[(4-propan-2-ylphenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 3655252 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-(2-methylphenyl)-N'-[(4-propan-2-ylphenyl)methylideneamino]propanediamide |
| SMILES | Cc1ccccc1NC(=O)CC(=O)NN=Cc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C20H23N3O2/c1-14(2)17-10-8-16(9-11-17)13-21-23-20(25)12-19(24)22-18-7-5-4-6-15(18)3/h4-11,13-14H,12H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | RIBCGVFFHSJLFI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|