C29H33N5O — CID 36554051
4-(1H-benzimidazol-2-yl)-N-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]butanamide (PubChem CID 36554051) has the molecular formula C29H33N5O and a molecular weight of 467.62 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-N-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]butanamide.
| Compound Name | 4-(1H-benzimidazol-2-yl)-N-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 36554051 |
| Molecular Formula | C29H33N5O |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-N-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]butanamide |
| SMILES | O=C(CCCc1nc2ccccc2[nH]1)NCc1ccccc1CN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C29H33N5O/c35-29(16-8-15-28-31-26-13-6-7-14-27(26)32-28)30-21-23-9-4-5-10-24(23)22-33-17-19-34(20-18-33)25-11-2-1-3-12-25/h1-7,9-14H,8,15-22H2,(H,30,35)(H,31,32) |
| InChIKey | MFWTYTNMGLELPL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |