C22H26N4O5S — CID 3658102
N-[2-hydroxy-1-[5-[2-(2-methoxyphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]ethyl]-4-methoxybenzamide (PubChem CID 3658102) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is N-[2-hydroxy-1-[5-[2-(2-methoxyphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]ethyl]-4-methoxybenzamide.
| Compound Name | N-[2-hydroxy-1-[5-[2-(2-methoxyphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 3658102 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N-[2-hydroxy-1-[5-[2-(2-methoxyphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]ethyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(CO)c2nnc(SCCOc3ccccc3OC)n2C)cc1 |
| InChI | InChI=1S/C22H26N4O5S/c1-26-20(17(14-27)23-21(28)15-8-10-16(29-2)11-9-15)24-25-22(26)32-13-12-31-19-7-5-4-6-18(19)30-3/h4-11,17,27H,12-14H2,1-3H3,(H,23,28) |
| InChIKey | QAUKYMCXXOFLSQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|