About (3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate
(3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate (PubChem CID 36582524) has the molecular formula C15H14ClN3O5
and a molecular weight of 351.75 g/mol. Its IUPAC name is (3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | (3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate |
| PubChem CID | 36582524 |
| Molecular Formula | C15H14ClN3O5 |
| Molecular Weight | 351.75 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | (3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate |
| SMILES | CCCc1noc(COC(=O)/C=C/c2ccc(Cl)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C15H14ClN3O5/c1-2-3-13-17-14(24-18-13)9-23-15(20)7-5-10-4-6-11(16)12(8-10)19(21)22/h4-8H,2-3,9H2,1H3/b7-5+ |
| InChIKey | SNZBOYBWFDPOEK-FNORWQNLSA-N |
| XLogP | 3.34 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate?
The IUPAC name of (3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate (CID 36582524) is (3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate.
What is the SMILES notation for (3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate?
The canonical SMILES for (3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate is CCCc1noc(COC(=O)/C=C/c2ccc(Cl)c([N+](=O)[O-])c2)n1.
What is the InChIKey of (3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate?
The InChIKey is SNZBOYBWFDPOEK-FNORWQNLSA-N. The full InChI is InChI=1S/C15H14ClN3O5/c1-2-3-13-17-14(24-18-13)9-23-15(20)7-5-10-4-6-11(16)12(8-10)19(21)22/h4-8H,2-3,9H2,1H3/b7-5+.
What are the key properties of (3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate?
(3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate has a molecular weight of 351.75 g/mol, XLogP of 3.34, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate is sourced from PubChem (CID 36582524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).