C15H14ClN3O5 — CID 36582524
(3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate (PubChem CID 36582524) has the molecular formula C15H14ClN3O5 and a molecular weight of 351.75 g/mol. Its IUPAC name is (3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate.
| Compound Name | (3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 36582524 |
| Molecular Formula | C15H14ClN3O5 |
| Molecular Weight | 351.75 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | (3-propyl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate |
| SMILES | CCCc1noc(COC(=O)/C=C/c2ccc(Cl)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C15H14ClN3O5/c1-2-3-13-17-14(24-18-13)9-23-15(20)7-5-10-4-6-11(16)12(8-10)19(21)22/h4-8H,2-3,9H2,1H3/b7-5+ |
| InChIKey | SNZBOYBWFDPOEK-FNORWQNLSA-N |
| XLogP | 3.34 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|