C18H15F2N5O2 — CID 36586115
1-[[4-(difluoromethoxy)anilino]methyl]-4-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 36586115) has the molecular formula C18H15F2N5O2 and a molecular weight of 371.35 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)anilino]methyl]-4-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[[4-(difluoromethoxy)anilino]methyl]-4-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 36586115 |
| Molecular Formula | C18H15F2N5O2 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 1-[[4-(difluoromethoxy)anilino]methyl]-4-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | Cn1c(=O)c2ccccc2n2c(CNc3ccc(OC(F)F)cc3)nnc12 |
| InChI | InChI=1S/C18H15F2N5O2/c1-24-16(26)13-4-2-3-5-14(13)25-15(22-23-18(24)25)10-21-11-6-8-12(9-7-11)27-17(19)20/h2-9,17,21H,10H2,1H3 |
| InChIKey | REZMYIMOLXBDQW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|