C13H13N7OS — CID 3659443
7-azido-4,14,14-trimethyl-13-oxa-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 3659443) has the molecular formula C13H13N7OS and a molecular weight of 315.36 g/mol. Its IUPAC name is 7-azido-4,14,14-trimethyl-13-oxa-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 7-azido-4,14,14-trimethyl-13-oxa-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 3659443 |
| Molecular Formula | C13H13N7OS |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 7-azido-4,14,14-trimethyl-13-oxa-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | Cc1nc2c3c4c(sc3nc(N=[N+]=[N-])n2n1)COC(C)(C)C4 |
| InChI | InChI=1S/C13H13N7OS/c1-6-15-10-9-7-4-13(2,3)21-5-8(7)22-11(9)16-12(17-19-14)20(10)18-6/h4-5H2,1-3H3 |
| InChIKey | LQBBWZAFGLYBET-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 101.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|