C26H24N4O4 — CID 3660517
4-tert-butyl-N-[4-[5-(4-methyl-3-nitrophenyl)-1,2,4-oxadiazol-3-yl]phenyl]benzamide (PubChem CID 3660517) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[5-(4-methyl-3-nitrophenyl)-1,2,4-oxadiazol-3-yl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[5-(4-methyl-3-nitrophenyl)-1,2,4-oxadiazol-3-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 3660517 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 4-tert-butyl-N-[4-[5-(4-methyl-3-nitrophenyl)-1,2,4-oxadiazol-3-yl]phenyl]benzamide |
| SMILES | Cc1ccc(-c2nc(-c3ccc(NC(=O)c4ccc(C(C)(C)C)cc4)cc3)no2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H24N4O4/c1-16-5-6-19(15-22(16)30(32)33)25-28-23(29-34-25)17-9-13-21(14-10-17)27-24(31)18-7-11-20(12-8-18)26(2,3)4/h5-15H,1-4H3,(H,27,31) |
| InChIKey | QGGYWLUMDHPCBF-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|