C16H16N4O4S — CID 36618671
3,4-dimethoxy-N-(6-pyrazol-1-yl-3-pyridinyl)benzenesulfonamide (PubChem CID 36618671) has the molecular formula C16H16N4O4S and a molecular weight of 360.40 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(6-pyrazol-1-yl-3-pyridinyl)benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N-(6-pyrazol-1-yl-3-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 36618671 |
| Molecular Formula | C16H16N4O4S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 3,4-dimethoxy-N-(6-pyrazol-1-yl-3-pyridinyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(-n3cccn3)nc2)cc1OC |
| InChI | InChI=1S/C16H16N4O4S/c1-23-14-6-5-13(10-15(14)24-2)25(21,22)19-12-4-7-16(17-11-12)20-9-3-8-18-20/h3-11,19H,1-2H3 |
| InChIKey | DFVYVJXAZBRXDW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |