C19H18N2O4S — CID 110406353
3,4-dimethoxy-N-(6-phenyl-3-pyridinyl)benzenesulfonamide (PubChem CID 110406353) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(6-phenyl-3-pyridinyl)benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N-(6-phenyl-3-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110406353 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 3,4-dimethoxy-N-(6-phenyl-3-pyridinyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(-c3ccccc3)nc2)cc1OC |
| InChI | InChI=1S/C19H18N2O4S/c1-24-18-11-9-16(12-19(18)25-2)26(22,23)21-15-8-10-17(20-13-15)14-6-4-3-5-7-14/h3-13,21H,1-2H3 |
| InChIKey | FFZAXGQKQYQSMC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |