C18H17N3O5S — CID 122302279
3,4-dimethoxy-N-(2-phenoxypyrimidin-5-yl)benzenesulfonamide (PubChem CID 122302279) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(2-phenoxypyrimidin-5-yl)benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N-(2-phenoxypyrimidin-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 122302279 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 3,4-dimethoxy-N-(2-phenoxypyrimidin-5-yl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cnc(Oc3ccccc3)nc2)cc1OC |
| InChI | InChI=1S/C18H17N3O5S/c1-24-16-9-8-15(10-17(16)25-2)27(22,23)21-13-11-19-18(20-12-13)26-14-6-4-3-5-7-14/h3-12,21H,1-2H3 |
| InChIKey | UACCJFTUFBEUHD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |